68109-94-4 Usage
Description
[[3-[2-(dimethylamino)ethoxy]propyl]imino]bismethanol is a complex organic molecule with the formula C13H29N2O3. It features a propyl chain with an imine functional group and two methanol groups attached to the nitrogen atom. The molecule's structure is further complicated by the presence of dimethylamino and ethoxy groups, which contribute to its unique chemical properties and potential reactivity. This molecule may find applications in various fields, including pharmaceuticals, agrochemicals, and materials science, depending on the specific context and intended use.
Uses
Used in Pharmaceutical Applications:
[[3-[2-(dimethylamino)ethoxy]propyl]imino]bismethanol is used as an intermediate compound for the synthesis of various pharmaceutical products. Its unique chemical structure and reactivity make it a valuable building block in the development of new drugs.
Used in Agrochemical Applications:
In the agrochemical industry, [[3-[2-(dimethylamino)ethoxy]propyl]imino]bismethanol is used as a key component in the formulation of pesticides and other agricultural chemicals. Its specific properties may contribute to the effectiveness and selectivity of these products.
Used in Materials Science:
[[3-[2-(dimethylamino)ethoxy]propyl]imino]bismethanol is used as a component in the development of advanced materials, such as polymers and coatings, due to its unique chemical properties and potential reactivity. Its incorporation into these materials may enhance their performance characteristics, such as durability, stability, or functionality.
Used in Chemical Research:
As a complex organic molecule, [[3-[2-(dimethylamino)ethoxy]propyl]imino]bismethanol is used in chemical research to study its properties, reactivity, and potential applications. Researchers may use this molecule to explore new reaction pathways, develop novel synthetic methods, or investigate its interactions with other molecules and materials.
Check Digit Verification of cas no
The CAS Registry Mumber 68109-94-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,1,0 and 9 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 68109-94:
(7*6)+(6*8)+(5*1)+(4*0)+(3*9)+(2*9)+(1*4)=144
144 % 10 = 4
So 68109-94-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H22N2O3/c1-10(2)5-7-14-6-3-4-11(8-12)9-13/h12-13H,3-9H2,1-2H3