68139-00-4 Usage
Description
2,4-Dimethyl-2-(4-methyl-3-pentenyl)-1,3-dioxane, with the chemical formula C12H24O2, is a colorless liquid that exhibits a slightly sweet odor. This synthetic organic compound is primarily recognized for its application as a fragrance ingredient in the cosmetic and personal care industry, as well as in perfumery and as a flavoring agent. Moreover, it serves as a valuable chemical intermediate in the synthesis of other compounds. Due to its potential to cause skin and eye irritation, it is crucial to handle and store this chemical with caution, ensuring it is kept in a cool, well-ventilated area away from ignition sources.
Uses
Used in Cosmetic and Personal Care Industry:
2,4-Dimethyl-2-(4-methyl-3-pentenyl)-1,3-dioxane is utilized as a fragrance ingredient to impart pleasant and attractive scents to various cosmetic and personal care products. Its use enhances the sensory experience for consumers, making the products more appealing.
Used in Perfumery:
In the perfume industry, 2,4-Dimethyl-2-(4-methyl-3-pentenyl)-1,3-dioxane is employed to contribute to the complex and layered scent profiles of perfumes. Its incorporation helps create unique and enduring fragrances that can evoke specific moods or memories.
Used as a Flavoring Agent:
2,4-Dimethyl-2-(4-methyl-3-pentenyl)-1,3-dioxane is also used as a flavoring agent, adding depth and nuance to the taste of certain food products. Its slightly sweet odor can complement and enhance the flavor profiles of various edible items.
Used as a Chemical Intermediate:
Beyond its direct applications, 2,4-Dimethyl-2-(4-methyl-3-pentenyl)-1,3-dioxane serves as a crucial chemical intermediate in the synthesis of other compounds. Its role in chemical reactions allows for the creation of a wide range of products, demonstrating its versatility in the chemical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 68139-00-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,1,3 and 9 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 68139-00:
(7*6)+(6*8)+(5*1)+(4*3)+(3*9)+(2*0)+(1*0)=134
134 % 10 = 4
So 68139-00-4 is a valid CAS Registry Number.
InChI:InChI=1/C12H22O2/c1-10(2)6-5-8-12(4)13-9-7-11(3)14-12/h6,11H,5,7-9H2,1-4H3