68161-40-0 Usage
Uses
Used in Pharmaceutical Research:
(5-[(3-METHOXYPHENYL)AMINO]-1,3,4-THIADIAZOL-2-YLTHIO)ACETIC ACID is used as a potential therapeutic agent for various applications due to its biological activity. The presence of the thiadiazole ring, which is known for its antimicrobial, antiviral, and anticancer properties, makes it a promising candidate for the development of new drugs targeting these areas.
Used in Chemical Synthesis:
In the field of chemical synthesis, (5-[(3-METHOXYPHENYL)AMINO]-1,3,4-THIADIAZOL-2-YLTHIO)ACETIC ACID is utilized as a reactive intermediate for the creation of novel compounds. Its thioacetic acid group allows for further chemical reactions, making it a versatile building block for synthesizing a range of molecules with potential applications in various industries.
Used in Antimicrobial Applications:
(5-[(3-METHOXYPHENYL)AMINO]-1,3,4-THIADIAZOL-2-YLTHIO)ACETIC ACID is used as an antimicrobial agent for combating various types of bacteria and other microorganisms. Its thiadiazole-based structure contributes to its effectiveness in inhibiting microbial growth, making it a valuable component in the development of new antimicrobial drugs and treatments.
Used in Antiviral Applications:
In antiviral research, (5-[(3-METHOXYPHENYL)AMINO]-1,3,4-THIADIAZOL-2-YLTHIO)ACETIC ACID is employed as a potential antiviral agent. Its ability to interfere with viral replication and infection processes positions it as a candidate for the development of new antiviral medications, particularly for viruses that are resistant to existing treatments.
Used in Anticancer Applications:
(5-[(3-METHOXYPHENYL)AMINO]-1,3,4-THIADIAZOL-2-YLTHIO)ACETIC ACID is used as an anticancer agent for its potential to target and inhibit the growth of cancer cells. (5-[(3-METHOXYPHENYL)AMINO]-1,3,4-THIADIAZOL-2-YLTHIO)ACETIC ACID's structure allows it to interact with cellular components and signaling pathways, offering a new avenue for cancer treatment and potentially leading to the development of more effective therapies for various types of cancer.
Check Digit Verification of cas no
The CAS Registry Mumber 68161-40-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,1,6 and 1 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 68161-40:
(7*6)+(6*8)+(5*1)+(4*6)+(3*1)+(2*4)+(1*0)=130
130 % 10 = 0
So 68161-40-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H11N3O3S2/c1-17-8-4-2-3-7(5-8)12-10-13-14-11(19-10)18-6-9(15)16/h2-5H,6H2,1H3,(H,12,13)(H,15,16)
