6818-37-7 Usage
Description
BIS(HYDROXYETHYL)-AMINOPROPYL-N-HYDROXYETHYL-OCTADECYLAMINE DIHYDROFLUORIDE is a complex organic compound with a unique molecular structure that features hydroxyethyl and octadecylamine groups. BIS(HYDROXYETHYL)-AMINOPROPYL-N-HYDROXYETHYL-OCTADECYLAMINE DIHYDROFLUORIDE is characterized by its amphiphilic nature, which allows it to interact with both hydrophilic and hydrophobic substances. Its molecular structure endows it with potential applications in various fields, including pharmaceuticals, materials science, and chemical engineering.
Uses
Used in Pharmaceutical Industry:
BIS(HYDROXYETHYL)-AMINOPROPYL-N-HYDROXYETHYL-OCTADECYLAMINE DIHYDROFLUORIDE is used as a pharmaceutical agent for its potential therapeutic applications. BIS(HYDROXYETHYL)-AMINOPROPYL-N-HYDROXYETHYL-OCTADECYLAMINE DIHYDROFLUORIDE's amphiphilic properties enable it to interact with a wide range of biological targets, making it a promising candidate for the development of new drugs and therapies.
Used in Dental Care Industry:
BIS(HYDROXYETHYL)-AMINOPROPYL-N-HYDROXYETHYL-OCTADECYLAMINE DIHYDROFLUORIDE is used as an additive in oral care compositions for the reduction of tooth staining. Its cationic nature allows it to interact with the negatively charged surfaces of teeth, helping to prevent the accumulation of staining agents derived from various sources, such as food, beverages, and bacterial plaque.
Used in Materials Science:
In the field of materials science, BIS(HYDROXYETHYL)-AMINOPROPYL-N-HYDROXYETHYL-OCTADECYLAMINE DIHYDROFLUORIDE can be utilized as a component in the development of novel materials with specific properties. Its amphiphilic nature may contribute to the creation of materials with enhanced surface properties, improved biocompatibility, or unique self-assembly behaviors.
Used in Chemical Engineering:
BIS(HYDROXYETHYL)-AMINOPROPYL-N-HYDROXYETHYL-OCTADECYLAMINE DIHYDROFLUORIDE can be employed in chemical engineering processes as a surfactant or an emulsifying agent. Its ability to interact with both polar and non-polar substances makes it suitable for stabilizing emulsions, improving the solubility of various compounds, or facilitating specific chemical reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 6818-37-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,8,1 and 8 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 6818-37:
(6*6)+(5*8)+(4*1)+(3*8)+(2*3)+(1*7)=117
117 % 10 = 7
So 6818-37-7 is a valid CAS Registry Number.
InChI:InChI=1/C27H58N2O3.2FH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19-28(22-25-30)20-18-21-29(23-26-31)24-27-32;;/h30-32H,2-27H2,1H3;2*1H