68189-22-0 Usage
General Description
"[3-[bis[2-[(1-oxooctadecyl)amino]ethyl]amino]propylidyne]ethylammonium ethyl sulphate is a chemical compound with a complex molecular structure. It is an ethyl sulfate salt of a long-chain alkylamine derivative containing multiple amine groups. The molecule contains a propylidyne linking group and two ethylammonium groups, contributing to its amphiphilic nature. [3-[bis[2-[(1-oxooctadecyl)amino]ethyl]amino]propylidyne]ethylammonium ethyl sulphate likely has surfactant properties and can potentially be used in various industrial applications such as emulsifiers, detergents, and fabric softeners. However, due to its complex and specific structure, it may also have potential applications in biological and pharmaceutical research as a tool compound for understanding the interactions of long-chain amine derivatives with lipid membranes and other biological systems."
Check Digit Verification of cas no
The CAS Registry Mumber 68189-22-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,1,8 and 9 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 68189-22:
(7*6)+(6*8)+(5*1)+(4*8)+(3*9)+(2*2)+(1*2)=160
160 % 10 = 0
So 68189-22-0 is a valid CAS Registry Number.
InChI:InChI=1/C45H88N4O2.C2H6O4S/c1-4-7-9-11-13-15-17-19-21-23-25-27-29-31-33-36-44(50)47-39-42-49(41-35-38-46-6-3)43-40-48-45(51)37-34-32-30-28-26-24-22-20-18-16-14-12-10-8-5-2;1-2-6-7(3,4)5/h4-37,39-43H2,1-3H3,(H-,47,48,50,51);2H2,1H3,(H,3,4,5)