68239-05-4 Usage
General Description
"(2-hydroxy-1,1-dimethylethyl)ammonium palmitate" is a chemical compound that consists of a hydroxy-terminated quaternary ammonium salt and a fatty acid. The (2-hydroxy-1,1-dimethylethyl)ammonium cation has a hydroxyl functional group, while the palmitate anion is derived from the fatty acid palmitic acid. (2-hydroxy-1,1-dimethylethyl)ammonium palmitate is often used as a surfactant or emulsifying agent in various industrial and cosmetic applications. It has the ability to reduce surface tension and promote the formation of stable emulsions, making it useful in products such as lotions, creams, and hair care formulations. Additionally, it can also be employed in the production of pharmaceuticals and chemical synthesis processes.
Check Digit Verification of cas no
The CAS Registry Mumber 68239-05-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,2,3 and 9 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 68239-05:
(7*6)+(6*8)+(5*2)+(4*3)+(3*9)+(2*0)+(1*5)=144
144 % 10 = 4
So 68239-05-4 is a valid CAS Registry Number.
InChI:InChI=1/C16H32O2.C4H11NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;1-4(2,5)3-6/h2-15H2,1H3,(H,17,18);6H,3,5H2,1-2H3
