68239-62-3 Usage
General Description
The chemical "1-(2-chlorophenyl)-3-methyl-1H-pyrazole-4,5-dione 4-[(4-dodecylphenyl)hydrazone]" is a compound with a molecular structure consisting of a pyrazole ring with a 2-chlorophenyl and a methyl group attached. It also contains a dione group and a hydrazone group. The hydrazone group is linked to a dodecylphenyl group. This chemical may have potential applications in pharmaceuticals, agrochemicals, and materials science due to its unique molecular structure and potential biological activities. Further research and testing are needed to fully understand the properties and potential uses of this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 68239-62-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,2,3 and 9 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 68239-62:
(7*6)+(6*8)+(5*2)+(4*3)+(3*9)+(2*6)+(1*2)=153
153 % 10 = 3
So 68239-62-3 is a valid CAS Registry Number.
InChI:InChI=1/C28H37ClN4O/c1-3-4-5-6-7-8-9-10-11-12-15-23-18-20-24(21-19-23)30-31-27-22(2)32-33(28(27)34)26-17-14-13-16-25(26)29/h13-14,16-21,30H,3-12,15H2,1-2H3/b31-27+