68258-95-7 Usage
Uses
Used in Chemical Research:
2,4-dimethyl-2-(4-methylpent-3-enyl)-1,3-dioxolane is used as a research compound for its unique structural properties. 2,4-dimethyl-2-(4-methylpent-3-enyl)-1,3-dioxolane's complex arrangement of atoms and bonds provides a basis for studying the behavior and interactions of organosilicon compounds in various chemical reactions and processes.
Used in Industrial Applications:
Although information on the specific uses of 2,4-dimethyl-2-(4-methylpent-3-enyl)-1,3-dioxolane in industry is limited, its potential applications may include serving as an intermediate or additive in the synthesis of more complex molecules or materials. 2,4-dimethyl-2-(4-methylpent-3-enyl)-1,3-dioxolane's unique structure could be leveraged in the development of new products or processes in the chemical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 68258-95-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,2,5 and 8 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 68258-95:
(7*6)+(6*8)+(5*2)+(4*5)+(3*8)+(2*9)+(1*5)=167
167 % 10 = 7
So 68258-95-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H20O2/c1-9(2)6-5-7-11(4)12-8-10(3)13-11/h6,10H,5,7-8H2,1-4H3
