68259-00-7 Usage
Uses
Used in Organic Synthesis:
Methyl 1-methyl-4-[(methylphenylhydrazono)methyl]pyridinium sulphate is used as a synthetic intermediate for the preparation of various organic compounds. Its unique structure allows it to participate in a range of chemical reactions, facilitating the synthesis of target molecules.
Used in Chemical Reactions as a Reagent:
In the field of chemistry, methyl 1-methyl-4-[(methylphenylhydrazono)methyl]pyridinium sulphate serves as a reagent in specific chemical processes. Its ability to form complexes or participate in reactions due to its functional groups makes it a valuable component in advancing chemical research and development.
(Note: The exact applications and industries where methyl 1-methyl-4-[(methylphenylhydrazono)methyl]pyridinium sulphate is used would require further investigation, as the provided materials do not specify any particular industry or application. The uses listed are general and based on the compound's potential chemical properties and reactivity.)
Check Digit Verification of cas no
The CAS Registry Mumber 68259-00-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,2,5 and 9 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 68259-00:
(7*6)+(6*8)+(5*2)+(4*5)+(3*9)+(2*0)+(1*0)=147
147 % 10 = 7
So 68259-00-7 is a valid CAS Registry Number.
InChI:InChI=1/C14H16N3.CH4O4S/c1-16-10-8-13(9-11-16)12-15-17(2)14-6-4-3-5-7-14;1-5-6(2,3)4/h3-12H,1-2H3;1H3,(H,2,3,4)/q+1;/p-1
