682803-80-1 Usage
Uses
Used in Pharmaceutical Industry:
3-AMINO-3-(2-CHLORO-6-FLUORO-PHENYL)-PROPIONIC ACID is utilized as a key intermediate in the synthesis of various pharmaceuticals for its ability to contribute to the development of new drugs with potential therapeutic effects. Its unique structure allows for the creation of molecules with specific biological activities, enhancing the range of treatments available for various medical conditions.
Used in Agrochemical Industry:
In the agrochemical sector, 3-AMINO-3-(2-CHLORO-6-FLUORO-PHENYL)-PROPIONIC ACID serves as a crucial component in the formulation of crop protection products. Its incorporation aids in the development of effective pesticides and herbicides, ensuring the health and productivity of agricultural crops while minimizing the impact of pests and diseases.
Used in Chemical Research and Development:
3-AMINO-3-(2-CHLORO-6-FLUORO-PHENYL)-PROPIONIC ACID is employed as a versatile compound in chemical research and development. It is used to explore new chemical reactions and syntheses, leading to the discovery of novel compounds with potential applications in various industries. Its reactivity and structural features make it an attractive candidate for further exploration and innovation in the chemical sciences.
Check Digit Verification of cas no
The CAS Registry Mumber 682803-80-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,8,2,8,0 and 3 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 682803-80:
(8*6)+(7*8)+(6*2)+(5*8)+(4*0)+(3*3)+(2*8)+(1*0)=181
181 % 10 = 1
So 682803-80-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H9ClFNO2/c10-5-2-1-3-6(11)9(5)7(12)4-8(13)14/h1-3,7H,4,12H2,(H,13,14)
