682804-76-8 Usage
Uses
Used in Pharmaceutical Industry:
3-Amino-4-(4-fluoro-phenyl)-butyric acid is utilized as a building block in the synthesis of pharmaceuticals and other organic molecules. Its molecular structure and properties contribute to its potential applications in drug discovery and medicinal chemistry, where it can be used to create new drugs or improve existing ones.
Used in Organic Chemistry Research:
In the realm of organic chemistry, 3-Amino-4-(4-fluoro-phenyl)-butyric acid serves as a valuable tool for researchers. Its unique structure allows for the exploration of various chemical reactions and interactions, furthering the understanding of organic compounds and their applications in different fields.
Check Digit Verification of cas no
The CAS Registry Mumber 682804-76-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,8,2,8,0 and 4 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 682804-76:
(8*6)+(7*8)+(6*2)+(5*8)+(4*0)+(3*4)+(2*7)+(1*6)=188
188 % 10 = 8
So 682804-76-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H12FNO2/c11-8-3-1-7(2-4-8)5-9(12)6-10(13)14/h1-4,9H,5-6,12H2,(H,13,14)
