68385-79-5 Usage
Description
N-[3-amino-4-(2-methoxyethoxy)phenyl]acetamide is a chemical compound with the molecular formula C11H16N2O3. It is an amide derivative of acetamide, featuring an amino group, a phenyl group, and an ethoxy group. N-[3-amino-4-(2-methoxyethoxy)phenyl]acetamide holds potential pharmaceutical applications due to its capacity to modulate biological pathways and engage with specific protein targets, making it a candidate for the development of new drugs to address conditions such as inflammation, pain, and neurological disorders. It can also act as a building block for synthesizing more complex organic molecules with medicinal properties. Further research and testing are required to delineate its precise therapeutic potential and mechanism of action.
Uses
Used in Pharmaceutical Industry:
N-[3-amino-4-(2-methoxyethoxy)phenyl]acetamide is used as a potential drug candidate for the development of new medications targeting conditions such as inflammation, pain, and neurological disorders. Its unique structure allows it to interact with specific biological pathways and protein targets, offering a promising avenue for therapeutic intervention.
Used in Organic Synthesis:
In the field of organic chemistry, N-[3-amino-4-(2-methoxyethoxy)phenyl]acetamide serves as a building block for the synthesis of more complex organic molecules with medicinal properties. Its versatile chemical structure facilitates the creation of a variety of compounds with potential applications in drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 68385-79-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,3,8 and 5 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 68385-79:
(7*6)+(6*8)+(5*3)+(4*8)+(3*5)+(2*7)+(1*9)=175
175 % 10 = 5
So 68385-79-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H16N2O3/c1-8(14)13-9-3-4-11(10(12)7-9)16-6-5-15-2/h3-4,7H,5-6,12H2,1-2H3,(H,13,14)