68391-17-3 Usage
Uses
Used in Pharmaceutical Industry:
5-[[[[4-[(3-carboxy-4-hydroxyphenyl)azo]phenyl]thio]phenyl]azo]salicylic acid is used as a pharmaceutical compound for its potential therapeutic properties. The presence of multiple functional groups, including carboxylic acid and hydroxyphenyl, may contribute to its bioactivity and interactions with biological targets, making it a candidate for drug development.
Used in Cosmetics Industry:
In the cosmetics industry, 5-[[[[4-[(3-carboxy-4-hydroxyphenyl)azo]phenyl]thio]phenyl]azo]salicylic acid is used as an active ingredient for its potential skin benefits. 5-[[[[4-[(3-carboxy-4-hydroxyphenyl)azo]phenyl]thio]phenyl]azo]salicylic acid's structure and functional groups may provide exfoliating and anti-inflammatory properties, similar to those of salicylic acid, making it a valuable addition to skincare formulations.
Used in Material Science:
5-[[[[4-[(3-carboxy-4-hydroxyphenyl)azo]phenyl]thio]phenyl]azo]salicylic acid is used in material science for its potential applications in the development of new materials with unique properties. 5-[[[[4-[(3-carboxy-4-hydroxyphenyl)azo]phenyl]thio]phenyl]azo]salicylic acid's complex structure and multiple functional groups may enable the creation of novel materials with specific characteristics, such as color, stability, or reactivity, for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 68391-17-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,3,9 and 1 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 68391-17:
(7*6)+(6*8)+(5*3)+(4*9)+(3*1)+(2*1)+(1*7)=153
153 % 10 = 3
So 68391-17-3 is a valid CAS Registry Number.
InChI:InChI=1/C26H18N4O6S/c31-23-11-5-17(13-21(23)25(33)34)29-27-15-1-7-19(8-2-15)37-20-9-3-16(4-10-20)28-30-18-6-12-24(32)22(14-18)26(35)36/h1-14,27-28H,(H,33,34)(H,35,36)/b29-17+,30-18+