68391-17-3 Usage
General Description
5-[[[[4-[(3-carboxy-4-hydroxyphenyl)azo]phenyl]thio]phenyl]azo]salicylic acid is a complex chemical compound with a long and intricate structure. It consists of a salicylic acid core with two azo groups and multiple thio and phenyl groups attached to it. The compound contains a carboxylic acid and hydroxyphenyl group, adding to its complexity. It is a derivative of salicylic acid, a common ingredient in skincare products known for its exfoliating and anti-inflammatory properties. The intricate structure and multiple functional groups in 5-[[[[4-[(3-carboxy-4-hydroxyphenyl)azo]phenyl]thio]phenyl]azo]salicylic acid suggest potential applications in various fields, including pharmaceuticals, cosmetics, and material science.
Check Digit Verification of cas no
The CAS Registry Mumber 68391-17-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,3,9 and 1 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 68391-17:
(7*6)+(6*8)+(5*3)+(4*9)+(3*1)+(2*1)+(1*7)=153
153 % 10 = 3
So 68391-17-3 is a valid CAS Registry Number.
InChI:InChI=1/C26H18N4O6S/c31-23-11-5-17(13-21(23)25(33)34)29-27-15-1-7-19(8-2-15)37-20-9-3-16(4-10-20)28-30-18-6-12-24(32)22(14-18)26(35)36/h1-14,27-28H,(H,33,34)(H,35,36)/b29-17+,30-18+