68391-24-2 Usage
General Description
The chemical "[4-[(2-chlorophenyl)[4-(diethylamino)phenyl]methylene]-2,5-cyclohexadien-1-ylidene]diethylammonium chloride" is a compound that belongs to the class of quaternary ammonium salts. It consists of a complex ring structure with various functional groups, including a chlorophenyl group, a diethylamino group, and a cyclohexadienylidene group. The chloride salt form indicates that this compound contains a positively charged nitrogen atom. This chemical may have potential applications in various fields, including organic synthesis, pharmaceuticals, and materials science, due to its unique molecular structure and properties. Additionally, its potential biological activity, toxicity, and stability should be further researched for its specific applications.
Check Digit Verification of cas no
The CAS Registry Mumber 68391-24-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,3,9 and 1 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 68391-24:
(7*6)+(6*8)+(5*3)+(4*9)+(3*1)+(2*2)+(1*4)=152
152 % 10 = 2
So 68391-24-2 is a valid CAS Registry Number.
InChI:InChI=1/C27H32ClN2.ClH/c1-5-29(6-2)23-17-13-21(14-18-23)27(25-11-9-10-12-26(25)28)22-15-19-24(20-16-22)30(7-3)8-4;/h9-20H,5-8H2,1-4H3;1H/q+1;/p-1