68400-47-5 Usage
Uses
Used in Organic Synthesis:
2,5-Diethoxy-4-((4-methylphenyl)thio)nitrobenzene is used as an intermediate in organic synthesis for the production of various organic compounds. Its unique structure with multiple functional groups allows for versatile chemical reactions, making it a valuable building block in the synthesis of complex organic molecules.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2,5-Diethoxy-4-((4-methylphenyl)thio)nitrobenzene is used as a precursor for the development of new drugs. Its structural features can be exploited to create novel pharmaceutical compounds with potential therapeutic applications. 2,5-Diethoxy-4-((4-methylphenyl)thio)nitrobenzene's reactivity and functional groups can be modified to design drugs with specific properties and activities.
Used as a Research Chemical:
2,5-Diethoxy-4-((4-methylphenyl)thio)nitrobenzene is also used as a research chemical in academic and industrial laboratories. It serves as a model compound for studying the properties and reactions of nitrobenzene derivatives. Researchers can use 2,5-Diethoxy-4-((4-methylphenyl)thio)nitrobenzene to investigate the effects of different substituents on the chemical behavior of nitrobenzene compounds and to develop new synthetic methods and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 68400-47-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,4,0 and 0 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 68400-47:
(7*6)+(6*8)+(5*4)+(4*0)+(3*0)+(2*4)+(1*7)=125
125 % 10 = 5
So 68400-47-5 is a valid CAS Registry Number.
InChI:InChI=1/C17H19NO4S/c1-4-21-15-11-17(23-13-8-6-12(3)7-9-13)16(22-5-2)10-14(15)18(19)20/h6-11H,4-5H2,1-3H3
