68413-58-1 Usage
Uses
Used in Organic Synthesis:
2,4-dimethoxybenzenediazonium trichlorozincate is used as a reagent for the conversion of aryl diazonium salts to aryl zinc reagents. This conversion allows for the functionalization of organic compounds, expanding the scope of chemical reactions and the synthesis of complex organic molecules.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2,4-dimethoxybenzenediazonium trichlorozincate is used as a coupling agent in the synthesis of biaryl compounds. Biaryl compounds are important structural motifs in many pharmaceuticals, and the use of this reagent facilitates the formation of these key structural elements, contributing to the development of new drugs.
Used in Agrochemical Industry:
Similarly, in the agrochemical industry, 2,4-dimethoxybenzenediazonium trichlorozincate is utilized as a coupling agent for the synthesis of biaryl compounds. These compounds are often found in agrochemicals, such as pesticides and herbicides, where they play a crucial role in the effectiveness and selectivity of these products.
Used in Materials Science:
2,4-dimethoxybenzenediazonium trichlorozincate is also used in materials science for the synthesis of novel materials with specific properties. The ability to form biaryl compounds through this reagent can lead to the development of new materials with tailored characteristics for various applications.
Used in Catalyst Research:
Furthermore, trichlorozincate complexes, including 2,4-dimethoxybenzenediazonium trichlorozincate, have been studied for their potential as catalysts in organic reactions. This research aims to improve the efficiency and selectivity of catalytic processes, which can have significant implications for the green chemistry and the overall sustainability of chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 68413-58-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,4,1 and 3 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 68413-58:
(7*6)+(6*8)+(5*4)+(4*1)+(3*3)+(2*5)+(1*8)=141
141 % 10 = 1
So 68413-58-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H9N2O2.3ClH.Zn/c1-11-6-3-4-7(10-9)8(5-6)12-2;;;;/h3-5H,1-2H3;3*1H;/q+1;;;;+2/p-3
