684249-99-8 Usage
General Description
"(3,5-Dimethyl-[1,2,4]triazol-1-yl)-acetic acid" is a chemical compound with the molecular formula C7H10N4O2. The molecule has multiple functional groups with an acetic acid group and a 1,2,4-triazol-1-yl group attached to a common carbon atom. The triazolyl group is a five-membered ring containing two nitrogen atoms and the acetic acid group is a carboxylic acid group. The presence of these functional groups gives rise to distinct chemical behaviors. Among several notable properties, its solubility, melting point, boiling point, and density might be crucial for understanding its interactions with other substances. However, specific details about its physical properties, chemical reactivity, and potential applications in industrial or scientific fields might vary and are not mentioned here.
Check Digit Verification of cas no
The CAS Registry Mumber 684249-99-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,8,4,2,4 and 9 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 684249-99:
(8*6)+(7*8)+(6*4)+(5*2)+(4*4)+(3*9)+(2*9)+(1*9)=208
208 % 10 = 8
So 684249-99-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H9N3O2/c1-4-7-5(2)9(8-4)3-6(10)11/h3H2,1-2H3,(H,10,11)
