684249-99-8 Usage
Uses
Used in Chemical Synthesis:
(3,5-Dimethyl-[1,2,4]triazol-1-yl)-acetic acid is used as a building block or intermediate in the synthesis of more complex organic compounds. Its functional groups can participate in various chemical reactions, such as esterification, amidation, or condensation, to form a wide range of products.
Used in Pharmaceutical Industry:
(3,5-Dimethyl-[1,2,4]triazol-1-yl)-acetic acid is used as a potential pharmaceutical candidate for the development of new drugs. Its unique structure and functional groups may allow it to interact with biological targets, such as enzymes or receptors, and exhibit therapeutic effects.
Used in Material Science:
(3,5-Dimethyl-[1,2,4]triazol-1-yl)-acetic acid is used as a component in the development of new materials with specific properties. Its chemical structure may contribute to the formation of novel polymers, coatings, or other materials with applications in various industries.
Used in Research and Development:
(3,5-Dimethyl-[1,2,4]triazol-1-yl)-acetic acid is used as a research tool in academic and industrial laboratories. Its chemical properties and reactivity can be studied to gain insights into new reaction mechanisms, synthesis strategies, or potential applications in different fields.
Check Digit Verification of cas no
The CAS Registry Mumber 684249-99-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,8,4,2,4 and 9 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 684249-99:
(8*6)+(7*8)+(6*4)+(5*2)+(4*4)+(3*9)+(2*9)+(1*9)=208
208 % 10 = 8
So 684249-99-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H9N3O2/c1-4-7-5(2)9(8-4)3-6(10)11/h3H2,1-2H3,(H,10,11)
