68500-34-5 Usage
Description
4-HYDRAZINO-7-METHYLQUINOLINE is a chemical compound with the molecular formula C10H9N3 and a molecular weight of 159.2 g/mol. It is a derivative of quinoline, featuring a hydrazino group and a methyl group. 4-HYDRAZINO-7-METHYLQUINOLINE has garnered interest due to its potential applications in various fields, including as a fluorescent probe for detecting metals, particularly copper ions, and for its possible biological activities such as antiviral and anticancer properties. Furthermore, it has been considered for use in organic synthesis and as a building block for creating other chemical compounds.
Uses
Used in Analytical Chemistry:
4-HYDRAZINO-7-METHYLQUINOLINE is used as a fluorescent probe for the detection of metal ions, specifically copper ions, due to its ability to exhibit fluorescence upon binding with these ions. This property makes it a valuable tool in analytical chemistry for sensitive and selective metal ion detection.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 4-HYDRAZINO-7-METHYLQUINOLINE is explored as a potential antiviral and anticancer agent. Its biological activities are under investigation for possible therapeutic applications, particularly in the development of treatments for viral infections and various types of cancer.
Used in Organic Synthesis:
4-HYDRAZINO-7-METHYLQUINOLINE serves as a building block in organic synthesis, contributing to the creation of a variety of chemical compounds. Its unique structure allows it to be a versatile component in the synthesis of new molecules with potential applications in various industries.
Used in Chemical Compound Preparation:
As a key intermediate, 4-HYDRAZINO-7-METHYLQUINOLINE is utilized in the preparation of other chemical compounds, expanding its utility across different chemical processes and industries. Its role in compound preparation underscores its importance in advancing chemical research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 68500-34-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,5,0 and 0 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 68500-34:
(7*6)+(6*8)+(5*5)+(4*0)+(3*0)+(2*3)+(1*4)=125
125 % 10 = 5
So 68500-34-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H11N3/c1-7-2-3-8-9(13-11)4-5-12-10(8)6-7/h2-6H,11H2,1H3,(H,12,13)