68516-49-4 Usage
Uses
Used in Research and Laboratory Settings:
2,7-DIBROMO-1,3,6,8(2H,7H)-PYRENETETONE is used as a fluorescent probe for identifying and labeling biomolecules. Its fluorescent properties make it a valuable tool in the study of biological processes and interactions.
Used in Synthesis of Advanced Materials:
In the field of materials science, 2,7-DIBROMO-1,3,6,8(2H,7H)-PYRENETETONE is utilized in the synthesis of advanced materials for electronic and optoelectronic applications. Its unique structure and properties contribute to the development of innovative materials with potential uses in various technologies.
Used in Photodynamic Therapy Research:
2,7-DIBROMO-1,3,6,8(2H,7H)-PYRENETETONE is being studied for its potential as a photosensitizer in photodynamic therapy for cancer treatment. Its ability to absorb light and generate reactive oxygen species makes it a candidate for targeted cancer therapies, where it could be activated by light to destroy cancer cells while minimizing damage to healthy tissue.
Check Digit Verification of cas no
The CAS Registry Mumber 68516-49-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,5,1 and 6 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 68516-49:
(7*6)+(6*8)+(5*5)+(4*1)+(3*6)+(2*4)+(1*9)=154
154 % 10 = 4
So 68516-49-4 is a valid CAS Registry Number.
InChI:InChI=1/C16H6Br2O4/c17-11-13(19)5-1-2-6-10-8(16(22)12(18)14(6)20)4-3-7(9(5)10)15(11)21/h1-4,11-12H
