68548-73-2 Usage
Uses
Used in Pharmaceutical Industry:
2-(4-PHENOXYPHENYL)-PYRROLIDINE is used as a building block for the synthesis of bioactive molecules, contributing to the development of new drugs. Its unique structure allows for the creation of compounds with specific therapeutic properties, making it a valuable asset in drug discovery and design.
Used in Agrochemical Industry:
2-(4-PHENOXYPHENYL)-PYRROLIDINE is utilized as a precursor in the synthesis of agrochemicals, such as pesticides and herbicides. Its ability to form various bioactive molecules enables the development of effective and targeted agricultural chemicals that can improve crop protection and yield.
Given the compound's potential applications, it is crucial to conduct further research to understand its full capabilities and ensure its safe and effective use in both the pharmaceutical and agrochemical sectors.
Check Digit Verification of cas no
The CAS Registry Mumber 68548-73-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,5,4 and 8 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 68548-73:
(7*6)+(6*8)+(5*5)+(4*4)+(3*8)+(2*7)+(1*3)=172
172 % 10 = 2
So 68548-73-2 is a valid CAS Registry Number.
InChI:InChI=1/C16H17NO/c1-2-5-14(6-3-1)18-15-10-8-13(9-11-15)16-7-4-12-17-16/h1-3,5-6,8-11,16-17H,4,7,12H2
