68548-75-4 Usage
General Description
2-(3-Phenoxyphenyl)-pyrrolidine, also known as 3-PPP, is a chemical compound that belongs to the class of pyrrolidine derivatives. It is primarily used as a research chemical and has shown potential as a psychoactive substance. 3-PPP is a potent dopamine reuptake inhibitor, meaning it increases the levels of dopamine in the brain by preventing its reabsorption. This has led to its investigation as a potential treatment for conditions such as attention deficit hyperactivity disorder (ADHD) and Parkinson's disease. However, due to its psychoactive properties, 3-PPP is also considered a controlled substance in some jurisdictions and is subject to legal restrictions. Overall, 3-PPP is a compound that holds promise for therapeutic applications, but its regulation and potential for misuse and abuse must also be carefully considered.
Check Digit Verification of cas no
The CAS Registry Mumber 68548-75-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,5,4 and 8 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 68548-75:
(7*6)+(6*8)+(5*5)+(4*4)+(3*8)+(2*7)+(1*5)=174
174 % 10 = 4
So 68548-75-4 is a valid CAS Registry Number.
InChI:InChI=1/C16H17NO/c1-2-7-14(8-3-1)18-15-9-4-6-13(12-15)16-10-5-11-17-16/h1-4,6-9,12,16-17H,5,10-11H2
