68548-77-6 Usage
General Description
2-(2-Phenoxyphenyl)-pyrrolidine is a chemical compound with the molecular formula C17H17NO. It is a white to off-white crystalline powder with a molecular weight of 255.32 g/mol. 2-(2-PHENOXYPHENYL)-PYRROLIDINE is used in the pharmaceutical industry as an intermediate in the synthesis of various drugs, specifically in the production of antipsychotic and antidepressant medications. It is also utilized as a building block for the production of other organic compounds. Additionally, 2-(2-Phenoxyphenyl)-pyrrolidine has been studied for its potential therapeutic effects and biological activities, making it an area of interest in medicinal chemistry research. However, its specific uses and applications in medicine and industry may vary depending on the specific formulation and context.
Check Digit Verification of cas no
The CAS Registry Mumber 68548-77-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,5,4 and 8 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 68548-77:
(7*6)+(6*8)+(5*5)+(4*4)+(3*8)+(2*7)+(1*7)=176
176 % 10 = 6
So 68548-77-6 is a valid CAS Registry Number.
InChI:InChI=1/C16H17NO/c1-2-7-13(8-3-1)18-16-11-5-4-9-14(16)15-10-6-12-17-15/h1-5,7-9,11,15,17H,6,10,12H2