68588-39-6 Usage
Uses
Used in Pharmaceutical Research and Development:
6-Chloro-N-ethylpyridazin-3-amine serves as a valuable building block in the synthesis of biologically active molecules. Its unique structure and functional groups make it a promising candidate for the development of new drugs with potential therapeutic applications.
Used in Agrochemical Applications:
6-Chloro-N-ethylpyridazin-3-amine has been investigated for its potential use in agrochemicals, where it could contribute to the development of new pesticides or other agricultural chemicals that improve crop yield and protect against pests.
Used in Environmental Studies:
6-Chloro-N-ethylpyridazin-3-amine has also been studied for its environmental impact, which is crucial for understanding how it may interact with ecosystems and for ensuring the safety and sustainability of its applications in various industries.
Used in Therapeutic Agent Development:
6-Chloro-N-ethylpyridazin-3-amine has shown potential as a therapeutic agent against certain diseases, making it a subject of interest for further research and development in the medical field. Its specific pharmacological properties are still under investigation, but its potential role in treating diseases highlights its importance in the healthcare sector.
Check Digit Verification of cas no
The CAS Registry Mumber 68588-39-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,5,8 and 8 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 68588-39:
(7*6)+(6*8)+(5*5)+(4*8)+(3*8)+(2*3)+(1*9)=186
186 % 10 = 6
So 68588-39-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H8ClN3/c1-2-8-6-4-3-5(7)9-10-6/h3-4H,2H2,1H3,(H,8,10)
