68733-63-1 Usage
Uses
Used in Organic Synthesis:
DIPHENYLMETHYL(DIMETHYLAMINO)SILANE is used as a reagent in organic synthesis for its high reactivity, which facilitates various chemical transformations and the formation of new compounds.
Used as a Crosslinking Agent in Polymer Production:
In the polymer industry, DIPHENYLMETHYL(DIMETHYLAMINO)SILANE is utilized as a crosslinking agent, enhancing the properties of polymers, resins, and coatings by creating a network structure that improves their mechanical strength, durability, and chemical resistance.
Used as a Catalyst in Hydrosilylation Reactions:
DIPHENYLMETHYL(DIMETHYLAMINO)SILANE serves as a catalyst in the hydrosilylation of alkenes, a reaction that adds a silicon-hydrogen bond across a carbon-carbon double bond. This process is crucial in the synthesis of organosilicon compounds and the modification of polymers to impart specific properties.
Used in Ring-Opening Polymerization of Cyclic Monomers:
This organosilicon compound is also employed as a catalyst in the ring-opening polymerization of cyclic monomers, a process that allows for the synthesis of polymers with controlled molecular weights and architectures, which is essential for tailoring material properties for specific applications.
Safety Precautions:
It is important to handle DIPHENYLMETHYL(DIMETHYLAMINO)SILANE with care due to its potential to cause severe skin and eye irritation. Additionally, it may be harmful if inhaled or ingested, necessitating proper safety measures during its use in laboratories and industrial settings.
Check Digit Verification of cas no
The CAS Registry Mumber 68733-63-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,7,3 and 3 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 68733-63:
(7*6)+(6*8)+(5*7)+(4*3)+(3*3)+(2*6)+(1*3)=161
161 % 10 = 1
So 68733-63-1 is a valid CAS Registry Number.
InChI:InChI=1/C15H19NSi/c1-16(2)17-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12,15H,17H2,1-2H3
