68758-65-6 Usage
Molecular structure
1-ethyl-2-[3-(1-ethyl-1H-quinolin-4-ylidene)-1-propenyl]naphtho[1,2-d]thiazolium toluene-p-sulphonate consists of a thiazolium ring, a naphtho group, and a toluene-p-sulphonate moiety.
Functional groups
The compound contains an ethyl group (-CH2CH3) and a quinolin-4-ylidene group.
Fluorescent properties
The compound exhibits fluorescence, making it potentially useful in various applications.
Potential applications
Due to its unique chemical structure and reactivity, the compound has potential uses in organic synthesis, material science, and pharmaceutical research.
Complexity
The compound is a complex chemical entity, which may require further studies to fully explore its properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 68758-65-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,7,5 and 8 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 68758-65:
(7*6)+(6*8)+(5*7)+(4*5)+(3*8)+(2*6)+(1*5)=186
186 % 10 = 6
So 68758-65-6 is a valid CAS Registry Number.
InChI:InChI=1/C27H25N2S.C7H8O3S/c1-3-28-19-18-21(22-12-7-8-14-24(22)28)11-9-15-26-29(4-2)27-23-13-6-5-10-20(23)16-17-25(27)30-26;1-6-2-4-7(5-3-6)11(8,9)10/h5-19H,3-4H2,1-2H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1