68758-77-0 Usage
Functional groups
chloro, oxo, amino, carboxylic acid
Properties
likely acidic and potentially toxic, lipophilic properties due to isoicosenoic acid chain
Structure
long and intricate
Biological and chemical properties
require further analysis and research to fully understand
Check Digit Verification of cas no
The CAS Registry Mumber 68758-77-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,7,5 and 8 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 68758-77:
(7*6)+(6*8)+(5*7)+(4*5)+(3*8)+(2*7)+(1*7)=190
190 % 10 = 0
So 68758-77-0 is a valid CAS Registry Number.
InChI:InChI=1/C37H48Cl4N4O4/c1-25(2)16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-26(37(48)49)20-34(46)42-28-18-19-29(39)32(23-28)43-33-24-35(47)45(44-33)36-30(40)21-27(38)22-31(36)41/h3-4,18-19,21-23,25-26H,5-17,20,24H2,1-2H3,(H,42,46)(H,43,44)(H,48,49)/b4-3+