68758-84-9 Usage
General Description
Triethylammonium 5-(3-ethylbenzothiazol-2(3H)-ylidene)-2-thioxothiazolidine-3-acetate is a complex chemical compound that contains a triethylammonium cation and a heterocyclic molecule with a benzothiazole ring. The compound also includes a thioxothiazolidine ring and an acetate group. This chemical has potential applications in various fields, including pharmaceuticals, as it may possess biological activity due to its complex structure. Further research is needed to elucidate the specific properties and potential uses of this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 68758-84-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,7,5 and 8 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 68758-84:
(7*6)+(6*8)+(5*7)+(4*5)+(3*8)+(2*8)+(1*4)=189
189 % 10 = 9
So 68758-84-9 is a valid CAS Registry Number.
InChI:InChI=1/C14H14N2O2S3.C6H15N/c1-2-16-9-5-3-4-6-10(9)20-13(16)11-7-15(8-12(17)18)14(19)21-11;1-4-7(5-2)6-3/h3-6H,2,7-8H2,1H3,(H,17,18);4-6H2,1-3H3/b13-11+;