687635-04-7 Usage
Uses
Used in Pharmaceutical Industry:
3-Pyrazol-1-yl-benzylamine is used as a building block for the preparation of various pharmaceuticals due to its ability to form stable and bioactive molecules. Its presence in the molecular structure can enhance the drug's efficacy and selectivity, contributing to the development of novel therapeutic agents.
Used in Agrochemical Industry:
In the agrochemical sector, 3-pyrazol-1-yl-benzylamine is utilized as a key component in the synthesis of agrochemicals, such as pesticides and herbicides. Its incorporation into these compounds can improve their effectiveness in controlling pests and weeds, ensuring better crop protection.
Used in Coordination Chemistry:
3-Pyrazol-1-yl-benzylamine serves as a ligand in coordination chemistry, forming complexes with metal ions. These complexes exhibit unique properties and applications, such as catalysis, sensing, and materials science, due to the coordination of the pyrazole and benzyl groups with metal centers.
Used in Organic Reactions:
As a reagent in organic reactions, 3-pyrazol-1-yl-benzylamine facilitates various synthetic transformations, such as cross-coupling, cyclization, and functional group interconversions. Its presence can enhance the reaction efficiency and selectivity, enabling the synthesis of complex organic molecules with desired properties.
Overall, the diverse applications of 3-pyrazol-1-yl-benzylamine across different industries highlight its importance as a versatile intermediate in organic synthesis, contributing to the development of innovative pharmaceuticals, agrochemicals, and other fine chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 687635-04-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,8,7,6,3 and 5 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 687635-04:
(8*6)+(7*8)+(6*7)+(5*6)+(4*3)+(3*5)+(2*0)+(1*4)=207
207 % 10 = 7
So 687635-04-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H11N3/c11-8-9-3-1-4-10(7-9)13-6-2-5-12-13/h1-7H,8,11H2
687635-04-7Relevant academic research and scientific papers
DPP-IV INHIBITORS
-
Page/Page column 54, (2010/02/14)
The invention relates to compounds of formula (I), Z-C(R1R 2)-C(R3NH2)-C(R4R5)-X-N(R 6R7), wherein Z, R1-7 and X have the meaning as cited in the description and the claims. Said compounds are useful as DPP-lV inhibitors. The invention also relates to the
