68797-47-7 Usage
Type of compound
Quaternary ammonium compound
Functional group
Methacrylate group
Primary use
Reactive monomer in the production of polymer materials
Industries
Dentistry and biomaterials
Properties
+ Excellent adhesive properties
+ Cationic nature allowing binding to negatively charged surfaces
+ Can introduce positive charges into polymers
Benefits
+ Valuable component in the formulation of adhesives, coatings, and dental materials
+ Enhances antimicrobial and antifouling properties of polymers
+ Versatile and valuable chemical with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 68797-47-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,7,9 and 7 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 68797-47:
(7*6)+(6*8)+(5*7)+(4*9)+(3*7)+(2*4)+(1*7)=197
197 % 10 = 7
So 68797-47-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H11NO2.H2O4S/c1-5(2)6(8)9-4-3-7;1-5(2,3)4/h1,3-4,7H2,2H3;(H2,1,2,3,4)
