68901-16-6 Usage
Explanation
The molecular formula represents the number of atoms of each element present in a molecule of the compound.
Explanation
Urea derivatives are compounds that have a urea functional group (-NH2-CO-NH2) as part of their structure.
Explanation
Thioethers are compounds containing a sulfur atom bonded to two carbon atoms or a carbon and a heteroatom. In this case, the sulfur atom is connecting the imidazole ring to the urea derivative.
Explanation
The compound is mainly utilized in scientific research to study its effects on biological systems and to explore its potential applications.
Explanation
Although further research is needed, the compound may have uses in the medical and pharmaceutical fields due to its unique structure and properties.
Explanation
The exact properties, applications, and potential benefits of 1-[[(1-methyl-1H-imidazol-2-yl)thio]methyl]-3-phenylurea are not yet fully understood, and ongoing research is being conducted to determine these aspects.
Urea derivative
A chemical compound derived from urea
Thioether linked imidazole moiety
A sulfur atom connecting an imidazole ring to the rest of the molecule
Phenyl group
A benzene ring with a single hydrogen atom replaced by a functional group
Research and experimental use
Primarily used in research and experimental settings
Potential applications
Medical and pharmaceutical industries
Ongoing investigation
Properties and uses are still being studied
Check Digit Verification of cas no
The CAS Registry Mumber 68901-16-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,9,0 and 1 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 68901-16:
(7*6)+(6*8)+(5*9)+(4*0)+(3*1)+(2*1)+(1*6)=146
146 % 10 = 6
So 68901-16-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H14N4OS/c1-16-8-7-13-12(16)18-9-14-11(17)15-10-5-3-2-4-6-10/h2-8H,9H2,1H3,(H2,14,15,17)
