69001-90-7 Usage
General Description
2-(2-quinoxalinylsulfanyl)acetic acid is a chemical compound with the molecular formula C11H8N2O2S. It is an organic compound that contains a quinoxaline ring and a thiol group. 2-(2-QUINOXALINYLSULFANYL)ACETIC ACID is primarily used in research and development as a building block for the synthesis of complex organic molecules. It has potential applications in medicinal chemistry and pharmaceutical research due to its structural and functional properties. Its unique chemical structure makes it a valuable intermediate in the synthesis of various bioactive molecules and pharmaceuticals. Additionally, the compound may have potential biological activity and could be studied for its potential therapeutic uses.
Check Digit Verification of cas no
The CAS Registry Mumber 69001-90-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,9,0,0 and 1 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 69001-90:
(7*6)+(6*9)+(5*0)+(4*0)+(3*1)+(2*9)+(1*0)=117
117 % 10 = 7
So 69001-90-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H8N2O2S/c13-10(14)6-15-9-5-11-7-3-1-2-4-8(7)12-9/h1-5H,6H2,(H,13,14)/p-1
69001-90-7Relevant articles and documents
Mesoionic compounds with a bridge nitrogen atom. 19. Thiazolo[3,2-a]quinoxalinium oxides
Fedotov,Romanov
, p. 1399 - 1402 (2007/10/02)
(2-Quinoxalylthio)acetic acids have been found to cyclize on treatment with acetic anhydride to give the mesoionic thiazolo[3,2-a]quinoxalinium oxides. Some reactions of these compounds have been studied, and the relationship of the color of the compounds
