69018-97-9 Usage
Molecular structure
A complex organic compound with a unique arrangement of atoms and functional groups.
Functional groups
Contains diethylamino, phenyl, quinazolin-4-yl, and aminophenol moieties.
Aromatic and heterocyclic structure
The compound has both aromatic (planar, unsaturated ring) and heterocyclic (ring containing more than one type of atom) structures, which may contribute to its pharmacological properties.
Potential applications
Medicinal chemistry and pharmaceutical research, due to its unique molecular structure and potential pharmacological properties.
Pharmacological properties
The compound's aromatic and heterocyclic structure may contribute to its pharmacological properties, which could be further investigated for drug development.
Research and analysis
Further research and analysis of the compound's chemical properties and potential biological activities could provide valuable insights for developing new drugs or therapeutic agents.
Chemical properties
The compound's chemical properties, such as reactivity, stability, and solubility, should be investigated to understand its behavior in different environments and its potential interactions with other molecules.
Biological activities
The compound's potential biological activities, such as its ability to interact with biological targets (e.g., enzymes, receptors) and its effects on cellular processes, should be studied to determine its therapeutic potential.
Drug development
The insights gained from studying the compound's chemical properties and biological activities could be used to develop new drugs or therapeutic agents with improved efficacy, safety, and selectivity.
Structure-activity relationship (SAR)
Investigating the relationship between the compound's molecular structure and its biological activities can help identify key structural features responsible for its pharmacological properties, which can be used to design more potent and selective analogs.
Check Digit Verification of cas no
The CAS Registry Mumber 69018-97-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,9,0,1 and 8 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 69018-97:
(7*6)+(6*9)+(5*0)+(4*1)+(3*8)+(2*9)+(1*7)=149
149 % 10 = 9
So 69018-97-9 is a valid CAS Registry Number.
InChI:InChI=1/C27H28N4O/c1-3-31(4-2)19-21-18-22(15-16-25(21)32)28-27-23-12-8-9-13-24(23)29-26(30-27)17-14-20-10-6-5-7-11-20/h5-18,32H,3-4,19H2,1-2H3,(H,28,29,30)
69018-97-9Relevant articles and documents
Synthesis of some 2-styrylquinazoline derivatives structurally related to certain chemotherapeutic agents.
Botros,Shaban
, p. 646 - 647 (2007/10/09)
The synthesis of certain 2-styryl-4-arylaminoquinazolines having the general formula 1 is described. 4-Chloro-2-styrylquinazolines were prepared by chlorination of 2-styryl-4-quinazolones in benzene solution using phosphorus oxychloride and an excess of dimethylaniline. Reacting the chlorostyrylquinazolines with certain arylamines afforded 1.