690632-01-0 Usage
General Description
[6-(1-Pyrrolidinyl)-3-pyridinyl]methanol is a chemical compound with the molecular formula C12H15NO. It is a derivative of both pyrrolidine and pyridine and contains a hydroxyl group. [6-(1-PYRROLIDINYL)-3-PYRIDINYL]METHANOL is commonly used as a building block in organic synthesis to create various pharmaceuticals, agrochemicals, and materials. It can also be used in the development of new chemical entities as a starting material for further chemical transformations. Additionally, [6-(1-pyrrolidinyl)-3-pyridinyl]methanol has potential applications in medicinal chemistry and drug discovery due to its structural features and potential pharmacological activities. Overall, this chemical plays a significant role in the development and synthesis of diverse functional molecules for various industrial and research purposes.
Check Digit Verification of cas no
The CAS Registry Mumber 690632-01-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,9,0,6,3 and 2 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 690632-01:
(8*6)+(7*9)+(6*0)+(5*6)+(4*3)+(3*2)+(2*0)+(1*1)=160
160 % 10 = 0
So 690632-01-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H14N2O/c13-8-9-3-4-10(11-7-9)12-5-1-2-6-12/h3-4,7,13H,1-2,5-6,8H2