690632-04-3 Usage
General Description
2-(2,3-Dihydro-1-benzofuran-5-yl)-4-methyl-1,3-thiazole-5-carboxylic acid is a chemical compound with a complex molecular structure consisting of a benzofuran ring fused to a thiazole ring. It also contains a carboxylic acid group and a methyl substituent. 2-(2,3-DIHYDRO-1-BENZOFURAN-5-YL)-4-METHYL-1,3-THIAZOLE-5-CARBOXYLIC ACID may be of interest for its potential biological activities, as benzofuran and thiazole derivatives are known to possess various pharmacological properties, such as antifungal, antiviral, and anti-inflammatory activities. Further research and investigation may be needed to determine the specific properties and potential uses of this chemical compound.
Check Digit Verification of cas no
The CAS Registry Mumber 690632-04-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,9,0,6,3 and 2 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 690632-04:
(8*6)+(7*9)+(6*0)+(5*6)+(4*3)+(3*2)+(2*0)+(1*4)=163
163 % 10 = 3
So 690632-04-3 is a valid CAS Registry Number.
InChI:InChI=1/C13H11NO3S/c1-7-11(13(15)16)18-12(14-7)9-2-3-10-8(6-9)4-5-17-10/h2-3,6H,4-5H2,1H3,(H,15,16)
