690632-04-3 Usage
Uses
Used in Pharmaceutical Industry:
2-(2,3-DIHYDRO-1-BENZOFURAN-5-YL)-4-METHYL-1,3-THIAZOLE-5-CARBOXYLIC ACID is used as a potential pharmaceutical agent for its possible antifungal, antiviral, and anti-inflammatory properties, which can be harnessed for the development of new drugs to treat various conditions.
Used in Chemical Research:
In the field of chemical research, 2-(2,3-DIHYDRO-1-BENZOFURAN-5-YL)-4-METHYL-1,3-THIAZOLE-5-CARBOXYLIC ACID serves as a subject for investigation to understand its specific properties, reactivity, and potential applications in the synthesis of other compounds with therapeutic or industrial uses.
Check Digit Verification of cas no
The CAS Registry Mumber 690632-04-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,9,0,6,3 and 2 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 690632-04:
(8*6)+(7*9)+(6*0)+(5*6)+(4*3)+(3*2)+(2*0)+(1*4)=163
163 % 10 = 3
So 690632-04-3 is a valid CAS Registry Number.
InChI:InChI=1/C13H11NO3S/c1-7-11(13(15)16)18-12(14-7)9-2-3-10-8(6-9)4-5-17-10/h2-3,6H,4-5H2,1H3,(H,15,16)
