690632-06-5 Usage
General Description
[3-[(4-METHYLPIPERIDINO)METHYL]PHENYL]METHANAMINE, also known as MPMPA, is a chemical compound with a molecular formula C16H24N2. It is an amine compound that contains a phenyl group and a piperidine ring substituted with a methyl group. MPMPA is commonly used in pharmaceutical research and development as a precursor or intermediate in the synthesis of various drugs and pharmaceutical compounds. It is also utilized in organic chemistry as a building block for the synthesis of more complex molecules. Additionally, MPMPA has potential applications in medicinal chemistry, particularly in the development of new therapeutic agents for various medical conditions. Overall, this chemical compound plays an important role in the synthesis of pharmaceuticals and has potential for further research and development in the pharmaceutical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 690632-06-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,9,0,6,3 and 2 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 690632-06:
(8*6)+(7*9)+(6*0)+(5*6)+(4*3)+(3*2)+(2*0)+(1*6)=165
165 % 10 = 5
So 690632-06-5 is a valid CAS Registry Number.
InChI:InChI=1/C14H22N2/c1-12-5-7-16(8-6-12)11-14-4-2-3-13(9-14)10-15/h2-4,9,12H,5-8,10-11,15H2,1H3