690632-12-3 Usage
Uses
Used in Pharmaceutical Industry:
[2-(3-CHLOROPHENYL)-1,3-THIAZOL-4-YL]METHANAMINE HYDROCHLORIDE MONOHYDRATE is used as a precursor or intermediate for the synthesis of various organic compounds, which may have pharmaceutical applications. Its unique structure and properties make it a valuable component in the development of new drugs and therapeutic agents.
Used in Research Applications:
In the field of medicinal chemistry, [2-(3-CHLOROPHENYL)-1,3-THIAZOL-4-YL]METHANAMINE HYDROCHLORIDE MONOHYDRATE is used as a research compound to explore its potential biological or therapeutic properties. Its structure and characteristics provide insights into the development of new compounds with specific pharmacological effects, contributing to the advancement of drug discovery and design.
Check Digit Verification of cas no
The CAS Registry Mumber 690632-12-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,9,0,6,3 and 2 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 690632-12:
(8*6)+(7*9)+(6*0)+(5*6)+(4*3)+(3*2)+(2*1)+(1*2)=163
163 % 10 = 3
So 690632-12-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H9ClN2S.ClH.H2O/c11-8-3-1-2-7(4-8)10-13-9(5-12)6-14-10;;/h1-4,6H,5,12H2;1H;1H2
