690632-27-0 Usage
Uses
Used in Pharmaceutical Research and Development:
(4-METHYLPIPERIDINO)(4-PIPERIDINYL)METHANONE HYDROCHLORIDE is used as a building block for the synthesis of various pharmaceutical compounds. Its unique structure and properties make it a valuable component in the development of new drugs and therapeutic agents.
Used in Organic Synthesis:
As a hydrochloride salt, (4-METHYLPIPERIDINO)(4-PIPERIDINYL)METHANONE HYDROCHLORIDE serves as a precursor in organic synthesis, allowing for the creation of a wide range of chemical compounds with diverse applications.
Used in Drug Production:
(4-METHYLPIPERIDINO)(4-PIPERIDINYL)METHANONE HYDROCHLORIDE has shown potential as an intermediate in the production of various drugs, contributing to the development of new medications and therapies.
Used in Biological Activity Studies:
This chemical compound has been studied for its potential pharmacological properties and biological activity, making it a valuable tool in understanding the mechanisms of action and potential therapeutic applications of related compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 690632-27-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,9,0,6,3 and 2 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 690632-27:
(8*6)+(7*9)+(6*0)+(5*6)+(4*3)+(3*2)+(2*2)+(1*7)=170
170 % 10 = 0
So 690632-27-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H22N2O/c1-10-4-8-14(9-5-10)12(15)11-2-6-13-7-3-11/h10-11,13H,2-9H2,1H3
