690632-70-3 Usage
Uses
Used in Pharmaceutical Research:
2-BROMO-1-(5-BROMO-2,3-DIHYDRO-1-BENZOFURAN-7-YL)ETHANONE is used as a chemical intermediate for the development of new drugs, particularly in the fields of anti-inflammatory and anticancer therapies. Its unique chemical structure and potential pharmacological effects make it a promising candidate for further research and development.
Used in Organic Synthesis:
2-BROMO-1-(5-BROMO-2,3-DIHYDRO-1-BENZOFURAN-7-YL)ETHANONE is used as a key intermediate in various organic transformations and reactions. Its reactivity as a brominated ketone allows for the synthesis of a wide range of chemical compounds, making it an important component in the field of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 690632-70-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,9,0,6,3 and 2 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 690632-70:
(8*6)+(7*9)+(6*0)+(5*6)+(4*3)+(3*2)+(2*7)+(1*0)=173
173 % 10 = 3
So 690632-70-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H8Br2O2/c11-5-9(13)8-4-7(12)3-6-1-2-14-10(6)8/h3-4H,1-2,5H2
