6908-24-3 Usage
Uses
Used in Pharmaceutical Industry:
(3α,4β,20S)-20-(Methylamino)-2',3,3',4-tetrahydro-2',3',4,14-tetramethyl-9β,19-cyclo-6'H-5α-pregn-3-eno[3,4-d][1,3]oxazin-16α-ol is used as a pharmaceutical compound for its potential therapeutic properties. Its unique structure and functional groups may contribute to its efficacy in treating various medical conditions.
Used in Chemical Research:
(3α,4β,20S)-20-(Methylamino)-2',3,3',4-tetrahydro-2',3',4,14-tetramethyl-9β,19-cyclo-6'H-5α-pregn-3-eno[3,4-d][1,3]oxazin-16α-ol is used as a research compound in the field of organic chemistry. Its complex structure and specific stereochemistry make it an interesting subject for studying synthesis methods, chemical properties, and potential applications in various fields.
Used in Drug Development:
(3α,4β,20S)-20-(Methylamino)-2',3,3',4-tetrahydro-2',3',4,14-tetramethyl-9β,19-cyclo-6'H-5α-pregn-3-eno[3,4-d][1,3]oxazin-16α-ol is used as a lead compound in drug development. Its unique structure and functional groups may provide a foundation for the design and development of new drugs with improved therapeutic properties and reduced side effects.
Check Digit Verification of cas no
The CAS Registry Mumber 6908-24-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,9,0 and 8 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 6908-24:
(6*6)+(5*9)+(4*0)+(3*8)+(2*2)+(1*4)=113
113 % 10 = 3
So 6908-24-3 is a valid CAS Registry Number.
InChI:InChI=1/C16H14ClNO3/c1-11-6-8-12(9-7-11)16(20)21-10-15(19)18-14-5-3-2-4-13(14)17/h2-9H,10H2,1H3,(H,18,19)
