69093-18-1 Usage
General Description
1-amino-4,8-dihydroxy-5-[(1-methylethyl)amino]anthraquinone is a chemical compound with the formula C20H17N3O4. It is an anthraquinone derivative with a substituted amino group, and it is commonly used as a pH indicator and in the production of dyes. The compound has a bright red color and is insoluble in water but soluble in organic solvents. It is known for its stability and resistance to light and heat, making it suitable for various industrial applications. Additionally, it has been studied for potential use in cancer treatment due to its ability to interfere with cellular processes. Overall, the compound has a wide range of uses and potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 69093-18-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,9,0,9 and 3 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 69093-18:
(7*6)+(6*9)+(5*0)+(4*9)+(3*3)+(2*1)+(1*8)=151
151 % 10 = 1
So 69093-18-1 is a valid CAS Registry Number.
InChI:InChI=1/C17H16N2O4/c1-7(2)19-9-4-6-11(21)15-13(9)17(23)14-10(20)5-3-8(18)12(14)16(15)22/h3-7,19-21H,18H2,1-2H3