691872-17-0 Usage
Uses
Used in Pharmaceutical Synthesis:
2-(5-bromopyridin-2-yl)ethanamine is utilized as an intermediate in the synthesis of various pharmaceutical drugs. Its unique structure and functional groups contribute to the development of new medications with potential therapeutic benefits.
Used in Organic Chemistry:
In the field of organic chemistry, 2-(5-bromopyridin-2-yl)ethanamine serves as a building block for the creation of more complex organic molecules. Its presence in these molecules can influence their reactivity, stability, and overall properties, making it a key component in the synthesis of specialty chemicals and materials.
Used in Research Applications:
2-(5-bromopyridin-2-yl)ethanamine is also employed in research settings to explore its chemical properties and potential interactions with other compounds. This research can lead to a better understanding of its applications and the discovery of new uses in various industries.
Used in Chemical Industry:
2-(5-bromopyridin-2-yl)ethanamine finds application in the chemical industry for the production of various chemical products. Its versatility allows it to be integrated into a wide range of formulations and processes, contributing to the development of innovative products and technologies.
Check Digit Verification of cas no
The CAS Registry Mumber 691872-17-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,9,1,8,7 and 2 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 691872-17:
(8*6)+(7*9)+(6*1)+(5*8)+(4*7)+(3*2)+(2*1)+(1*7)=200
200 % 10 = 0
So 691872-17-0 is a valid CAS Registry Number.
InChI:InChI=1S/C7H9BrN2/c8-6-1-2-7(3-4-9)10-5-6/h1-2,5H,3-4,9H2
