69198-37-4 Usage
Uses
Used in Pharmaceutical Development:
4-Allyl-5-(4-methoxy-benzyl)-4H-[1,2,4]triazole-3-thiol is used as a potential pharmaceutical compound for its possible biological and pharmacological activities. Its unique structure allows it to be explored for the development of new drugs and therapies.
Used in Agrochemicals:
In the agrochemical industry, 4-Allyl-5-(4-methoxy-benzyl)-4H-[1,2,4]triazole-3-thiol is used as a potential active ingredient for the development of new pesticides or other agricultural chemicals, leveraging its unique chemical properties to target specific pests or diseases.
Used as a Ligand in Coordination Chemistry:
4-Allyl-5-(4-methoxy-benzyl)-4H-[1,2,4]triazole-3-thiol is used as a ligand in coordination chemistry to form complexes with metal ions. This application takes advantage of its structural features to create new materials with potential uses in various fields, such as catalysis or sensing.
Further research and studies are necessary to fully explore the potential applications and properties of 4-Allyl-5-(4-methoxy-benzyl)-4H-[1,2,4]triazole-3-thiol, as its current uses are based on its unique structure and potential activities.
Check Digit Verification of cas no
The CAS Registry Mumber 69198-37-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,9,1,9 and 8 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 69198-37:
(7*6)+(6*9)+(5*1)+(4*9)+(3*8)+(2*3)+(1*7)=174
174 % 10 = 4
So 69198-37-4 is a valid CAS Registry Number.
InChI:InChI=1/C13H15N3OS/c1-3-8-16-12(14-15-13(16)18)9-10-4-6-11(17-2)7-5-10/h3-7H,1,8-9H2,2H3,(H,15,18)
69198-37-4Relevant academic research and scientific papers
Synthesis and reactions of new 4-methoxybenzyland 3-chloro-4-methoxybenzyl- substituted 1,2,4-triazoles and 1,3,4-thiadiazoles
Hovsepyan,Dilanyan,Minasyan,Melik-Ohanjanyan
, p. 736 - 741 (2014/07/08)
Intermolecular cyclization of 1-phenyl(benzyl, allyl)-4-(4-methoxybenzyl- or 3-chloro-4-methoxybenzyl) thiosemicarbazides afforded the corresponding 3,4,5-substituted 4H-1,2,4-triazoles. Reactions of Salkylation and aminomethylation of the latter were exa
