692-05-7 Usage
Uses
Used in Pharmaceutical Industry:
1,1,2-Trifluoro-1-decene is used as an intermediate in the synthesis of various pharmaceuticals for its unique properties as a fluorinated alkene, which can enhance the activity and selectivity of the resulting compounds.
Used in Agrochemical Industry:
1,1,2-Trifluoro-1-decene is used as an intermediate in the production of agrochemicals, where its fluorinated nature can improve the effectiveness and environmental stability of the final products.
Used in Surfactant Industry:
1,1,2-Trifluoro-1-decene is used as a building block for the development of surfactants with specialized properties, such as improved solubility and stability in various media.
Used in Organic Synthesis:
1,1,2-Trifluoro-1-decene is used as a reagent in organic synthesis, where its fluorinated alkene structure can be employed to create a variety of complex organic molecules with specific functionalities.
Used in Fluoropolymer Production:
1,1,2-Trifluoro-1-decene is utilized in the production of fluorinated polymers, which possess unique properties such as high thermal stability, chemical resistance, and low surface energy. These polymers find applications in various industries, including electronics, automotive, and aerospace.
Used in Specialty Materials Industry:
1,1,2-Trifluoro-1-decene is used in the development of other materials with specialized properties, such as high-performance lubricants, coatings, and adhesives, due to its fluorinated nature and reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 692-05-7 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 6,9 and 2 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 692-05:
(5*6)+(4*9)+(3*2)+(2*0)+(1*5)=77
77 % 10 = 7
So 692-05-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H17F3/c1-2-3-4-5-6-7-8-9(11)10(12)13/h2-8H2,1H3
