69214-13-7 Usage
Uses
Used in Pharmaceutical Industry:
5-bromo-3-chloroH-imidazo[1,2-a]pyridine is used as a building block for the synthesis of various pharmaceutical compounds. Its versatile chemical reactivity and functionalization capabilities make it a valuable component in the development of potential drug candidates.
Used in Agrochemical Industry:
In the agrochemical industry, 5-bromo-3-chloroH-imidazo[1,2-a]pyridine is utilized as a key intermediate for the synthesis of agrochemicals. Its unique structure and properties contribute to the creation of effective and targeted agrochemical products.
Used in Organic Materials:
5-bromo-3-chloroH-imidazo[1,2-a]pyridine is also employed in the synthesis of organic materials, where its specific chemical properties can be leveraged to create novel materials with desired characteristics.
Used in Medicinal Chemistry Research:
As a synthetic intermediate, 5-bromo-3-chloroH-imidazo[1,2-a]pyridine plays a crucial role in medicinal chemistry research. It aids in the development and optimization of new drug candidates, contributing to advancements in the field of medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 69214-13-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,9,2,1 and 4 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 69214-13:
(7*6)+(6*9)+(5*2)+(4*1)+(3*4)+(2*1)+(1*3)=127
127 % 10 = 7
So 69214-13-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H4BrClN2/c8-5-2-1-3-7-10-4-6(9)11(5)7/h1-4H
