69226-62-6 Usage
Uses
Used in Pharmaceutical Industry:
N-(2-Methoxyphenethyl)urea is used as a key intermediate in the synthesis of various pharmaceuticals and drugs. Its unique chemical structure and properties contribute to the development of new and effective medications.
Used in Drug Development:
In the field of medicine and drug development, N-(2-Methoxyphenethyl)urea plays a significant role. Its potential bioactive properties make it a valuable component in the creation of innovative and impactful treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 69226-62-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,9,2,2 and 6 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 69226-62:
(7*6)+(6*9)+(5*2)+(4*2)+(3*6)+(2*6)+(1*2)=146
146 % 10 = 6
So 69226-62-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H14N2O2/c1-14-9-5-3-2-4-8(9)6-7-12-10(11)13/h2-5H,6-7H2,1H3,(H3,11,12,13)
