69306-85-0 Usage
General Description
"3,5-dihydroxy-7-methoxy-2-(4-methoxyphenyl)-4-oxo-4H-1-benzopyran-8-yl butyrate is a synthetic chemical compound with a complex structure. It contains a benzopyran ring and a butyrate group, along with multiple hydroxy and methoxy substituents. 3,5-dihydroxy-7-methoxy-2-(4-methoxyphenyl)-4-oxo-4H-1-benzopyran-8-yl butyrate is believed to have potential biological activities due to its structural features, such as antioxidant and anti-inflammatory properties. However, further research is needed to fully understand its mechanisms of action and potential applications in medicine and other fields."
Check Digit Verification of cas no
The CAS Registry Mumber 69306-85-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,9,3,0 and 6 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 69306-85:
(7*6)+(6*9)+(5*3)+(4*0)+(3*6)+(2*8)+(1*5)=150
150 % 10 = 0
So 69306-85-0 is a valid CAS Registry Number.
InChI:InChI=1/C21H20O8/c1-4-5-15(23)28-20-14(27-3)10-13(22)16-17(24)18(25)19(29-21(16)20)11-6-8-12(26-2)9-7-11/h6-10,22,25H,4-5H2,1-3H3