6940-88-1 Usage
Uses
Used in Chemical Synthesis:
1-chloro-4-[3-chloro-1-(1-methylethoxy)propyl]benzene is used as a chemical intermediate for the production of various industrial products, such as dyes, pesticides, and pharmaceuticals. Its unique structure allows it to be a key component in the synthesis of these compounds, contributing to their color, efficacy, or therapeutic properties.
Used in Solvent Applications:
In the chemical industry, 1-chloro-4-[3-chloro-1-(1-methylethoxy)propyl]benzene also serves as a solvent in certain chemical reactions and processes. Its solubility properties make it suitable for dissolving other compounds and facilitating specific types of chemical transformations.
Used in Pharmaceutical Industry:
1-chloro-4-[3-chloro-1-(1-methylethoxy)propyl]benzene is used as a building block in the synthesis of pharmaceuticals. Its presence in the molecular structure of some drugs can influence their pharmacological activity, potentially enhancing their effectiveness or modifying their delivery to target tissues.
Used in Dye Industry:
In the dye industry, 1-chloro-4-[3-chloro-1-(1-methylethoxy)propyl]benzene is used as a precursor to create dyes with specific color characteristics. Its molecular structure contributes to the color intensity and stability of the dyes, making it an important component in the formulation of various colorants.
Used in Pesticide Industry:
1-chloro-4-[3-chloro-1-(1-methylethoxy)propyl]benzene is used as a component in the development of pesticides. Its chemical properties can be harnessed to enhance the effectiveness of these products, potentially increasing their ability to control pests while minimizing environmental impact.
Safety Considerations:
As a chlorinated compound, 1-chloro-4-[3-chloro-1-(1-methylethoxy)propyl]benzene requires careful handling and adherence to safety protocols to prevent health hazards. Proper protective equipment and disposal methods should be employed to ensure the safety of workers and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 6940-88-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,9,4 and 0 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 6940-88:
(6*6)+(5*9)+(4*4)+(3*0)+(2*8)+(1*8)=121
121 % 10 = 1
So 6940-88-1 is a valid CAS Registry Number.
InChI:InChI=1/C12H16Cl2O/c1-9(2)15-12(7-8-13)10-3-5-11(14)6-4-10/h3-6,9,12H,7-8H2,1-2H3
