69447-46-7 Usage
Uses
Used in Organic Synthesis:
3-bicyclo[2.2.1]hept-5-en-2-ylidenepropiononitrile is used as a building block in organic synthesis for creating more complex molecules. Its unique bicyclic structure and nitrile group contribute to its versatility in forming various organic compounds.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-bicyclo[2.2.1]hept-5-en-2-ylidenepropiononitrile is used as a key intermediate in the synthesis of drug molecules. Its structural features and reactivity make it suitable for developing new pharmaceutical compounds with potential therapeutic applications.
Used in Agrochemical Industry:
3-bicyclo[2.2.1]hept-5-en-2-ylidenepropiononitrile is also utilized in the agrochemical industry as a precursor for the development of agrochemical products. Its unique structure and functional group can be employed to create molecules with pesticidal or herbicidal properties.
Used in Materials Science:
In materials science, 3-bicyclo[2.2.1]hept-5-en-2-ylidenepropiononitrile is used as a starting material for the synthesis of advanced materials with specific properties. Its structural features and reactivity can be harnessed to develop new materials for various applications, such as polymers, coatings, or adhesives.
Check Digit Verification of cas no
The CAS Registry Mumber 69447-46-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,9,4,4 and 7 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 69447-46:
(7*6)+(6*9)+(5*4)+(4*4)+(3*7)+(2*4)+(1*6)=167
167 % 10 = 7
So 69447-46-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H11N/c11-5-1-2-9-6-8-3-4-10(9)7-8/h2-4,8,10H,1,6-7H2
69447-46-7Relevant academic research and scientific papers
Novel 2-(2-cyanoethylidene)-bicyclo[2.2.1]hept-5-enes and hydrogenated derivatives thereof
-
, (2008/06/13)
Novel 2-(2-cyanoethylidene)-bicyclo[2.2.1]hept-5-enes and hydrogenated derivatives thereof, their utility as olfactory agents, and perfume compositions containing them.
