69462-43-7 Usage
Uses
Used in Organic Synthesis:
1-(3-cyclohexen-1-ylcarbonyl)-2-methylpiperidine is used as a key intermediate in organic synthesis for the creation of various complex organic molecules. Its unique structure allows for versatile chemical reactions, making it a valuable component in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 1-(3-cyclohexen-1-ylcarbonyl)-2-methylpiperidine is utilized as a starting material or a building block in the development of new drugs and therapeutic agents. Its specific properties and potential uses may vary depending on the exact application and research context, but its presence in the development pipeline highlights its importance in advancing medical treatments.
Overall, 1-(3-cyclohexen-1-ylcarbonyl)-2-methylpiperidine is an important chemical compound with diverse potential applications in various industries and research fields, particularly in organic synthesis and pharmaceutical research.
Check Digit Verification of cas no
The CAS Registry Mumber 69462-43-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,9,4,6 and 2 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 69462-43:
(7*6)+(6*9)+(5*4)+(4*6)+(3*2)+(2*4)+(1*3)=157
157 % 10 = 7
So 69462-43-7 is a valid CAS Registry Number.
InChI:InChI=1/C13H21NO/c1-11-7-5-6-10-14(11)13(15)12-8-3-2-4-9-12/h2-3,11-12H,4-10H2,1H3
