69467-96-5 Usage
Description
2,3-Dihydrophthalazine-1,4-dione dihydrazone monomethanesulphonate is a chemical compound with the molecular formula C10H14N4O5S. It is a dihydrazone derivative of 2,3-Dihydrophthalazine-1,4-dione, which is commonly used in organic synthesis and pharmaceutical research. The monomethanesulphonate group in the compound indicates that it contains a single molecule of methanesulfonic acid. 2,3-Dihydrophthalazine-1,4-dione dihydrazone monomethanesulphonate has potential applications in research related to the development of pharmaceuticals and could be used as a reagent in organic chemical reactions. Additionally, its properties and potential uses in the field of medicine make it an interesting subject for further study.
Uses
Used in Pharmaceutical Research:
2,3-Dihydrophthalazine-1,4-dione dihydrazone monomethanesulphonate is used as a research compound for the development of pharmaceuticals due to its unique chemical structure and potential biological activity.
Used in Organic Synthesis:
2,3-Dihydrophthalazine-1,4-dione dihydrazone monomethanesulphonate is used as a reagent in organic chemical reactions, contributing to the synthesis of various organic compounds and aiding in the advancement of organic chemistry.
Used in Medicinal Chemistry:
2,3-Dihydrophthalazine-1,4-dione dihydrazone monomethanesulphonate is used in medicinal chemistry to explore its potential as a therapeutic agent, given its unique properties and the possibility of it interacting with biological targets.
Check Digit Verification of cas no
The CAS Registry Mumber 69467-96-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,9,4,6 and 7 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 69467-96:
(7*6)+(6*9)+(5*4)+(4*6)+(3*7)+(2*9)+(1*6)=185
185 % 10 = 5
So 69467-96-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H10N6.CH4O3S/c9-11-7-5-3-1-2-4-6(5)8(12-10)14-13-7;1-5(2,3)4/h1-4H,9-10H2,(H,11,13)(H,12,14);1H3,(H,2,3,4)